CAS 884497-58-9 is the registry number for 3-Bromo-5-chloro-4-ethoxybenzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
3-bromo-5-chloro-4-ethoxybenzaldehyde (CAS 884497-58-9) is a chemical compound with the molecular formula C9H8BrClO2 and a molecular weight of 263.51 g/mol. IUPAC name: 3-bromo-5-chloro-4-ethoxybenzaldehyde. InChIKey: BDNBQEWANMSSCP-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO2 |
|---|---|
| Molecular weight | 263.51 g/mol |
| IUPAC name | 3-bromo-5-chloro-4-ethoxybenzaldehyde |
| InChIKey | BDNBQEWANMSSCP-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1Br)C=O)Cl |
Computed by PubChem (NCBI)