Products 885123-57-9
CAS 885123-57-9 appears in our catalog under these names: Tetrahydrocannabivarin Acetate, Tetrahydrocannabivarin Acetate (exempt preparation), Tetrahydrocannabivarin acetate. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, Get quote.
[(6aR,10aR)-6,6,9-trimethyl-3-propyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] acetate (CAS 885123-57-9) is a chemical compound with the molecular formula C21H28O3 and a molecular weight of 328.4 g/mol. IUPAC name: [(6aR,10aR)-6,6,9-trimethyl-3-propyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] acetate. InChIKey: YIRFFZKTWADVGS-IAGOWNOFSA-N.
| Molecular formula | C21H28O3 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | [(6aR,10aR)-6,6,9-trimethyl-3-propyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] acetate |
| InChIKey | YIRFFZKTWADVGS-IAGOWNOFSA-N |
| SMILES | CCCC1=CC2=C([C@@H]3C=C(CC[C@H]3C(O2)(C)C)C)C(=C1)OC(=O)C |
Computed by PubChem (NCBI)