CAS 885268-78-0 is the registry number for 4-[4-(2-Methylphenoxy)phenylsulfonylaminomethyl]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-[[[4-(2-methylphenoxy)phenyl]sulfonylamino]methyl]benzoic acid (CAS 885268-78-0) is a chemical compound with the molecular formula C21H19NO5S and a molecular weight of 397.4 g/mol. IUPAC name: 4-[[[4-(2-methylphenoxy)phenyl]sulfonylamino]methyl]benzoic acid. InChIKey: RAJRZONWHZRZEN-UHFFFAOYSA-N.
| Molecular formula | C21H19NO5S |
|---|---|
| Molecular weight | 397.4 g/mol |
| IUPAC name | 4-[[[4-(2-methylphenoxy)phenyl]sulfonylamino]methyl]benzoic acid |
| InChIKey | RAJRZONWHZRZEN-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1OC2=CC=C(C=C2)S(=O)(=O)NCC3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)