Products 885269-44-3

CAS 885269-44-3 is the registry number for 4-(4'-Methoxy-4-biphenylylsulfonylaminomethyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-[[[4-(4-methoxyphenyl)phenyl]sulfonylamino]methyl]benzoic acid (CAS 885269-44-3) is a chemical compound with the molecular formula C21H19NO5S and a molecular weight of 397.4 g/mol. IUPAC name: 4-[[[4-(4-methoxyphenyl)phenyl]sulfonylamino]methyl]benzoic acid. InChIKey: QVOYNMQWWYYZBY-UHFFFAOYSA-N.

Identity
Molecular formulaC21H19NO5S
Molecular weight397.4 g/mol
IUPAC name4-[[[4-(4-methoxyphenyl)phenyl]sulfonylamino]methyl]benzoic acid
InChIKeyQVOYNMQWWYYZBY-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)C2=CC=C(C=C2)S(=O)(=O)NCC3=CC=C(C=C3)C(=O)O

Computed by PubChem (NCBI)