Products 885270-12-2

CAS 885270-12-2 is the registry number for (2,3-Dihydro-1H-indol-7-yl)-carbamic acid tert-butyl ester. Offered by: Biosynth. Available pack sizes: 0,25g, 0,1g, 0,5g, 2g, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl N-(2,3-dihydro-1H-indol-7-yl)carbamate (CAS 885270-12-2) is a chemical compound with the molecular formula C13H18N2O2 and a molecular weight of 234.29 g/mol. IUPAC name: tert-butyl N-(2,3-dihydro-1H-indol-7-yl)carbamate. InChIKey: SVLRQBLEXCOLQL-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18N2O2
Molecular weight234.29 g/mol
IUPAC nametert-butyl N-(2,3-dihydro-1H-indol-7-yl)carbamate
InChIKeySVLRQBLEXCOLQL-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1=CC=CC2=C1NCC2

Computed by PubChem (NCBI)