CAS 885272-43-5 is the registry number for 5-Furan-2-yl-1h-indazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
5-(furan-2-yl)-1H-indazole (CAS 885272-43-5) is a chemical compound with the molecular formula C11H8N2O and a molecular weight of 184.19 g/mol. IUPAC name: 5-(furan-2-yl)-1H-indazole. InChIKey: LAMFLSORFDHFFB-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | 5-(furan-2-yl)-1H-indazole |
| InChIKey | LAMFLSORFDHFFB-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=CC3=C(C=C2)NN=C3 |
Computed by PubChem (NCBI)