Products 885274-90-8
CAS 885274-90-8 is the registry number for N-Boc-4-(4-Oxo-Piperidine-1-Carbonyl)Aniline. Offered by: Biosynth. Available pack sizes: 100mg, 250mg, 500mg.
Tert-butyl N-[4-(4-oxopiperidine-1-carbonyl)phenyl]carbamate (CAS 885274-90-8) is a chemical compound with the molecular formula C17H22N2O4 and a molecular weight of 318.4 g/mol. IUPAC name: tert-butyl N-[4-(4-oxopiperidine-1-carbonyl)phenyl]carbamate. InChIKey: GECAEFBIYFYECB-UHFFFAOYSA-N.
| Molecular formula | C17H22N2O4 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | tert-butyl N-[4-(4-oxopiperidine-1-carbonyl)phenyl]carbamate |
| InChIKey | GECAEFBIYFYECB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=C(C=C1)C(=O)N2CCC(=O)CC2 |
Computed by PubChem (NCBI)