Products 885277-05-4
CAS 885277-05-4 appears in our catalog under these names: 2-Azepan-1-yl-isonicotinic acid hydrochloride, 95%, 2-Azepan-1-ylisonicotinic acid, 95%, 2–(Azepan–1–yl)isonicotinic acid, 2-(Azepan-1-yl)isonicotinic acid 95%, 2-AZEPAN-1-YLISONICOTINIC ACID, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
2-(azepan-1-yl)pyridine-4-carboxylic acid (CAS 885277-05-4) is a chemical compound with the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. IUPAC name: 2-(azepan-1-yl)pyridine-4-carboxylic acid. InChIKey: UYWSWXXMUJAYFS-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O2 |
|---|---|
| Molecular weight | 220.27 g/mol |
| IUPAC name | 2-(azepan-1-yl)pyridine-4-carboxylic acid |
| InChIKey | UYWSWXXMUJAYFS-UHFFFAOYSA-N |
| SMILES | C1CCCN(CC1)C2=NC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)