CAS 885461-57-4 is the registry number for 4-((2-Amino-1,3-thiazol-5-yl)methyl)benzene-1-sulfonamide, 95%. Offered by: AmBeed. Available pack sizes: 10g.
4-[(2-amino-1,3-thiazol-5-yl)methyl]benzenesulfonamide (CAS 885461-57-4) is a chemical compound with the molecular formula C10H11N3O2S2 and a molecular weight of 269.3 g/mol. IUPAC name: 4-[(2-amino-1,3-thiazol-5-yl)methyl]benzenesulfonamide. InChIKey: FEQXONVYCRAWHJ-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O2S2 |
|---|---|
| Molecular weight | 269.3 g/mol |
| IUPAC name | 4-[(2-amino-1,3-thiazol-5-yl)methyl]benzenesulfonamide |
| InChIKey | FEQXONVYCRAWHJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=CN=C(S2)N)S(=O)(=O)N |
Computed by PubChem (NCBI)