Products 885520-45-6
CAS 885520-45-6 is the registry number for 6-Bromo-4-methyl-1H-indazole-3-carboxylic acid. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g.
6-bromo-4-methyl-1H-indazole-3-carboxylic acid (CAS 885520-45-6) is a chemical compound with the molecular formula C9H7BrN2O2 and a molecular weight of 255.07 g/mol. IUPAC name: 6-bromo-4-methyl-1H-indazole-3-carboxylic acid. InChIKey: XEDFMABGSSAREN-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O2 |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | 6-bromo-4-methyl-1H-indazole-3-carboxylic acid |
| InChIKey | XEDFMABGSSAREN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1C(=NN2)C(=O)O)Br |
Computed by PubChem (NCBI)