CAS 885950-83-4 appears in our catalog under these names: [3-(3,5-Dichlorophenoxy)phenyl]sulfonyl chloride, 95%, 3-(3,5-Dichlorophenoxy)benzene-1-sulfonyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
3-(3,5-dichlorophenoxy)benzenesulfonyl chloride (CAS 885950-83-4) is a chemical compound with the molecular formula C12H7Cl3O3S and a molecular weight of 337.6 g/mol. IUPAC name: 3-(3,5-dichlorophenoxy)benzenesulfonyl chloride. InChIKey: DVZUMPKGJNNKQW-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl3O3S |
|---|---|
| Molecular weight | 337.6 g/mol |
| IUPAC name | 3-(3,5-dichlorophenoxy)benzenesulfonyl chloride |
| InChIKey | DVZUMPKGJNNKQW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)Cl)OC2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)