Products 885950-84-5

CAS 885950-84-5 is the registry number for [3-(3,4-Dichlorophenoxy)phenyl]sulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

3-(3,4-dichlorophenoxy)benzenesulfonyl chloride (CAS 885950-84-5) is a chemical compound with the molecular formula C12H7Cl3O3S and a molecular weight of 337.6 g/mol. IUPAC name: 3-(3,4-dichlorophenoxy)benzenesulfonyl chloride. InChIKey: GJIYPOUFLVRLMO-UHFFFAOYSA-N.

Identity
Molecular formulaC12H7Cl3O3S
Molecular weight337.6 g/mol
IUPAC name3-(3,4-dichlorophenoxy)benzenesulfonyl chloride
InChIKeyGJIYPOUFLVRLMO-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)S(=O)(=O)Cl)OC2=CC(=C(C=C2)Cl)Cl

Computed by PubChem (NCBI)