CAS 885961-37-5 is the registry number for 4-Butyl-N-hydroxybenzimidamide, 97%. Offered by: AmBeed. Available pack sizes: 5g.
4-butyl-N'-hydroxybenzenecarboximidamide (CAS 885961-37-5) is a chemical compound with the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. IUPAC name: 4-butyl-N'-hydroxybenzenecarboximidamide. InChIKey: LNSILFGWSYOPRX-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O |
|---|---|
| Molecular weight | 192.26 g/mol |
| IUPAC name | 4-butyl-N'-hydroxybenzenecarboximidamide |
| InChIKey | LNSILFGWSYOPRX-UHFFFAOYSA-N |
| SMILES | CCCCC1=CC=C(C=C1)/C(=N/O)/N |
Computed by PubChem (NCBI)