Products 886358-51-6
CAS 886358-51-6 appears in our catalog under these names: FFA3 agonist 1, FFA3-Agonist-1 95%, FFA3-Agonist-1, 95%, 95%, FFA3 agonist 1, 97.24%, 4-(Furan-2-yl)-2-methyl-5-oxo-N-(o-tolyl)-1,4,5,6,7,8-hexahydroquinoline-3-carboxamide, 95%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 100mg, 250mg, 1g, 10 mg.
4-(furan-2-yl)-2-methyl-N-(2-methylphenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide (CAS 886358-51-6) is a chemical compound with the molecular formula C22H22N2O3 and a molecular weight of 362.4 g/mol. IUPAC name: 4-(furan-2-yl)-2-methyl-N-(2-methylphenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide. InChIKey: HIWQJAGWEWRIIP-UHFFFAOYSA-N.
| Molecular formula | C22H22N2O3 |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | 4-(furan-2-yl)-2-methyl-N-(2-methylphenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide |
| InChIKey | HIWQJAGWEWRIIP-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1NC(=O)C2=C(NC3=C(C2C4=CC=CO4)C(=O)CCC3)C |
Computed by PubChem (NCBI)