CAS 886503-04-4 appears in our catalog under these names: 2,6-Dichloro-4-(trifluoromethoxy)benzyl alcohol, 95%, (2,6-Dichloro-4-(trifluoromethoxy)phenyl)methanol, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
[2,6-dichloro-4-(trifluoromethoxy)phenyl]methanol (CAS 886503-04-4) is a chemical compound with the molecular formula C8H5Cl2F3O2 and a molecular weight of 261.02 g/mol. IUPAC name: [2,6-dichloro-4-(trifluoromethoxy)phenyl]methanol. InChIKey: AVBJPIQFBNOCFY-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2F3O2 |
|---|---|
| Molecular weight | 261.02 g/mol |
| IUPAC name | [2,6-dichloro-4-(trifluoromethoxy)phenyl]methanol |
| InChIKey | AVBJPIQFBNOCFY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)CO)Cl)OC(F)(F)F |
Computed by PubChem (NCBI)