CAS 887268-35-1 is the registry number for 3-Chloro-4-(2-chloro-1,1,2-trifluoro-ethoxy)-phenol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-4-(2-chloro-1,1,2-trifluoroethoxy)phenol (CAS 887268-35-1) is a chemical compound with the molecular formula C8H5Cl2F3O2 and a molecular weight of 261.02 g/mol. IUPAC name: 3-chloro-4-(2-chloro-1,1,2-trifluoroethoxy)phenol. InChIKey: PCFFDWWKURUDNH-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2F3O2 |
|---|---|
| Molecular weight | 261.02 g/mol |
| IUPAC name | 3-chloro-4-(2-chloro-1,1,2-trifluoroethoxy)phenol |
| InChIKey | PCFFDWWKURUDNH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)Cl)OC(C(F)Cl)(F)F |
Computed by PubChem (NCBI)