Products 886767-01-7
CAS 886767-01-7 is the registry number for 3-(4-tert-Butyl-phenyl)-piperazine-1-carboxylic acid tert-butyl ester. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 3-(4-tert-butylphenyl)piperazine-1-carboxylate (CAS 886767-01-7) is a chemical compound with the molecular formula C19H30N2O2 and a molecular weight of 318.5 g/mol. IUPAC name: tert-butyl 3-(4-tert-butylphenyl)piperazine-1-carboxylate. InChIKey: YIWWHBLNPHYESE-UHFFFAOYSA-N.
| Molecular formula | C19H30N2O2 |
|---|---|
| Molecular weight | 318.5 g/mol |
| IUPAC name | tert-butyl 3-(4-tert-butylphenyl)piperazine-1-carboxylate |
| InChIKey | YIWWHBLNPHYESE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2CN(CCN2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)