CAS 887041-73-8 is the registry number for 4-(5-Amino-1,3,4-thiadiazol-2-yl)-1-(4-methylphenyl)pyrrolidin-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-(5-amino-1,3,4-thiadiazol-2-yl)-1-(4-methylphenyl)pyrrolidin-2-one (CAS 887041-73-8) is a chemical compound with the molecular formula C13H14N4OS and a molecular weight of 274.34 g/mol. IUPAC name: 4-(5-amino-1,3,4-thiadiazol-2-yl)-1-(4-methylphenyl)pyrrolidin-2-one. InChIKey: LXFQVUYPLJOOBY-UHFFFAOYSA-N.
| Molecular formula | C13H14N4OS |
|---|---|
| Molecular weight | 274.34 g/mol |
| IUPAC name | 4-(5-amino-1,3,4-thiadiazol-2-yl)-1-(4-methylphenyl)pyrrolidin-2-one |
| InChIKey | LXFQVUYPLJOOBY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2CC(CC2=O)C3=NN=C(S3)N |
Computed by PubChem (NCBI)