CAS 887344-31-2 appears in our catalog under these names: [1-(1,4-Dimethyl-1h-imidazol-2-yl)-ethyl]-carbamic acid tert-butyl ester, 95%, tert-Butyl (1-(1,4-dimethyl-1H-imidazol-2-yl)ethyl)carbamate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
Tert-butyl N-[1-(1,4-dimethylimidazol-2-yl)ethyl]carbamate (CAS 887344-31-2) is a chemical compound with the molecular formula C12H21N3O2 and a molecular weight of 239.31 g/mol. IUPAC name: tert-butyl N-[1-(1,4-dimethylimidazol-2-yl)ethyl]carbamate. InChIKey: OOFMNVSHHSUBLC-UHFFFAOYSA-N.
| Molecular formula | C12H21N3O2 |
|---|---|
| Molecular weight | 239.31 g/mol |
| IUPAC name | tert-butyl N-[1-(1,4-dimethylimidazol-2-yl)ethyl]carbamate |
| InChIKey | OOFMNVSHHSUBLC-UHFFFAOYSA-N |
| SMILES | CC1=CN(C(=N1)C(C)NC(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)