CAS 83797-69-7 appears in our catalog under these names: 2,4(1H,3H)-Pyrimidinedione, 6-(octylamino)-, 95%, 6-OAU, 6–OAU, 6-OAU, 98%, 98%, 6-OAU, min. 95 %, 25 mg. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg.
6-(octylamino)-1H-pyrimidine-2,4-dione (CAS 83797-69-7) is a chemical compound with the molecular formula C12H21N3O2 and a molecular weight of 239.31 g/mol. IUPAC name: 6-(octylamino)-1H-pyrimidine-2,4-dione. InChIKey: PFSWASUQURIOOR-UHFFFAOYSA-N.
| Molecular formula | C12H21N3O2 |
|---|---|
| Molecular weight | 239.31 g/mol |
| IUPAC name | 6-(octylamino)-1H-pyrimidine-2,4-dione |
| InChIKey | PFSWASUQURIOOR-UHFFFAOYSA-N |
| SMILES | CCCCCCCCNC1=CC(=O)NC(=O)N1 |
Computed by PubChem (NCBI)