CAS 887354-80-5 is the registry number for 2,2-Dimethyl-3-(4-mercaptophenyl)propionic Acid. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
2,2-dimethyl-3-(4-sulfanylphenyl)propanoic acid (CAS 887354-80-5) is a chemical compound with the molecular formula C11H14O2S and a molecular weight of 210.29 g/mol. IUPAC name: 2,2-dimethyl-3-(4-sulfanylphenyl)propanoic acid. InChIKey: XXDIJXPNRJHFRH-UHFFFAOYSA-N.
| Molecular formula | C11H14O2S |
|---|---|
| Molecular weight | 210.29 g/mol |
| IUPAC name | 2,2-dimethyl-3-(4-sulfanylphenyl)propanoic acid |
| InChIKey | XXDIJXPNRJHFRH-UHFFFAOYSA-N |
| SMILES | CC(C)(CC1=CC=C(C=C1)S)C(=O)O |
Computed by PubChem (NCBI)