Products 887354-80-5

CAS 887354-80-5 is the registry number for 2,2-Dimethyl-3-(4-mercaptophenyl)propionic Acid. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

2,2-dimethyl-3-(4-sulfanylphenyl)propanoic acid (CAS 887354-80-5) is a chemical compound with the molecular formula C11H14O2S and a molecular weight of 210.29 g/mol. IUPAC name: 2,2-dimethyl-3-(4-sulfanylphenyl)propanoic acid. InChIKey: XXDIJXPNRJHFRH-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14O2S
Molecular weight210.29 g/mol
IUPAC name2,2-dimethyl-3-(4-sulfanylphenyl)propanoic acid
InChIKeyXXDIJXPNRJHFRH-UHFFFAOYSA-N
SMILESCC(C)(CC1=CC=C(C=C1)S)C(=O)O

Computed by PubChem (NCBI)