CAS 887360-50-1 appears in our catalog under these names: 5-(4-Ethylphenyl)isoxazole-3-carboxylic acid, 95%, 5-(4-Ethylphenyl)-1,2-oxazole-3-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 2,5g.
5-(4-ethylphenyl)-1,2-oxazole-3-carboxylic acid (CAS 887360-50-1) is a chemical compound with the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. IUPAC name: 5-(4-ethylphenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: FNTZJQFGZFDXPX-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 5-(4-ethylphenyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | FNTZJQFGZFDXPX-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)