CAS 887360-66-9 is the registry number for 2-tert-Butylimidazo(1,2-a)pyrimidine. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-tert-butylimidazo[1,2-a]pyrimidine (CAS 887360-66-9) is a chemical compound with the molecular formula C10H13N3 and a molecular weight of 175.23 g/mol. IUPAC name: 2-tert-butylimidazo[1,2-a]pyrimidine. InChIKey: QCKNMBVCXLZFHY-UHFFFAOYSA-N.
| Molecular formula | C10H13N3 |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 2-tert-butylimidazo[1,2-a]pyrimidine |
| InChIKey | QCKNMBVCXLZFHY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CN2C=CC=NC2=N1 |
Computed by PubChem (NCBI)