Products 887578-83-8
CAS 887578-83-8 is the registry number for 4-Bromo-5-methyl-1H-indazole-3-carboxylic acid, 98%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 250mg, 1g, 100mg.
4-bromo-5-methyl-1H-indazole-3-carboxylic acid (CAS 887578-83-8) is a chemical compound with the molecular formula C9H7BrN2O2 and a molecular weight of 255.07 g/mol. IUPAC name: 4-bromo-5-methyl-1H-indazole-3-carboxylic acid. InChIKey: HIWOOFYIRGJINV-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O2 |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | 4-bromo-5-methyl-1H-indazole-3-carboxylic acid |
| InChIKey | HIWOOFYIRGJINV-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)NN=C2C(=O)O)Br |
Computed by PubChem (NCBI)