CAS 887588-06-9 is the registry number for (5-Nitropyridin-2-yl)methanamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(5-nitro-2-pyridinyl)methanamine (CAS 887588-06-9) is a chemical compound with the molecular formula C6H7N3O2 and a molecular weight of 153.14 g/mol. IUPAC name: (5-nitro-2-pyridinyl)methanamine. InChIKey: YHXMPLXAZQRIAA-UHFFFAOYSA-N.
| Molecular formula | C6H7N3O2 |
|---|---|
| Molecular weight | 153.14 g/mol |
| IUPAC name | (5-nitro-2-pyridinyl)methanamine |
| InChIKey | YHXMPLXAZQRIAA-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1[N+](=O)[O-])CN |
Computed by PubChem (NCBI)