CAS 887591-62-0 appears in our catalog under these names: 1–(tert–Butoxycarbonyl)–3–methylazetidine–3–carboxylic acid, 1-(tert-Butoxycarbonyl)-3-methylazetidine-3-carboxylic Acid, >98.0%(GC)(T), 1-(tert-Butoxycarbonyl)-3-methylazetidine-3-carboxylic acid, 1-(tert-Butoxycarbonyl)-3-methylazetidine-3-carboxylic acid, 97%. Offered by: GLPBio, TCI, Biosynth, Fluorochem, Ambeed. Available pack sizes: 10g, 1g, 250mg, 5g, 25g, 100g.
3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid (CAS 887591-62-0) is a chemical compound with the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. IUPAC name: 3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid. InChIKey: FNWBDXQPGAIDQH-UHFFFAOYSA-N.
| Molecular formula | C10H17NO4 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid |
| InChIKey | FNWBDXQPGAIDQH-UHFFFAOYSA-N |
| SMILES | CC1(CN(C1)C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)