Products 887987-72-6

CAS 887987-72-6 is the registry number for tert-butyl 2-((methylamino)methyl)morpholine-4-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Tert-butyl 2-(methylaminomethyl)morpholine-4-carboxylate (CAS 887987-72-6) is a chemical compound with the molecular formula C11H22N2O3 and a molecular weight of 230.30 g/mol. IUPAC name: tert-butyl 2-(methylaminomethyl)morpholine-4-carboxylate. InChIKey: KNVVDVAFPTYVMC-UHFFFAOYSA-N.

Identity
Molecular formulaC11H22N2O3
Molecular weight230.30 g/mol
IUPAC nametert-butyl 2-(methylaminomethyl)morpholine-4-carboxylate
InChIKeyKNVVDVAFPTYVMC-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCOC(C1)CNC

Computed by PubChem (NCBI)