CAS 88912-22-5 appears in our catalog under these names: 5-Chloro-2-methoxyisonicotinic acid, 96%, 5-Chloro-2-methoxyisonicotinic acid, 98%, 5-Chloro-2-methoxyisonicotinic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 10g, 5g, 1g, 25g, 250mg.
5-chloro-2-methoxypyridine-4-carboxylic acid (CAS 88912-22-5) is a chemical compound with the molecular formula C7H6ClNO3 and a molecular weight of 187.58 g/mol. IUPAC name: 5-chloro-2-methoxypyridine-4-carboxylic acid. InChIKey: LXHHWKXYDKBINP-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO3 |
|---|---|
| Molecular weight | 187.58 g/mol |
| IUPAC name | 5-chloro-2-methoxypyridine-4-carboxylic acid |
| InChIKey | LXHHWKXYDKBINP-UHFFFAOYSA-N |
| SMILES | COC1=NC=C(C(=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)