Products 889129-41-3
CAS 889129-41-3 is the registry number for 1-(3-Hydroxyphenyl)piperidin-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(3-hydroxyphenyl)piperidin-2-one (CAS 889129-41-3) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: 1-(3-hydroxyphenyl)piperidin-2-one. InChIKey: SCGGUDBECODJRE-UHFFFAOYSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | 1-(3-hydroxyphenyl)piperidin-2-one |
| InChIKey | SCGGUDBECODJRE-UHFFFAOYSA-N |
| SMILES | C1CCN(C(=O)C1)C2=CC(=CC=C2)O |
Computed by PubChem (NCBI)