Products 890-98-2
CAS 890-98-2 appears in our catalog under these names: Benzyl 2-hydroxy-2-phenylacetate, 98%, Benzylmandelate, 98%, DL-Mandelic acid benzyl ester, Benzyl DL-Mandelate, >98.0%(GC). Offered by: Chemat, BLDpharm, Fluorochem, Ambeed, Biosynth. Available pack sizes: 5g, 25g, 100g, 50g, 500g, 250g.
Benzyl 2-hydroxy-2-phenylacetate (CAS 890-98-2) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: benzyl 2-hydroxy-2-phenylacetate. InChIKey: JFKWZVQEMSKSBU-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | benzyl 2-hydroxy-2-phenylacetate |
| InChIKey | JFKWZVQEMSKSBU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C(C2=CC=CC=C2)O |
Computed by PubChem (NCBI)