Products 890591-72-7

CAS 890591-72-7 appears in our catalog under these names: 5-Cyclopropyl-1H-pyrazole-3-carboxylic acid 95%, 5-Cyclopropyl-1H-pyrazole-3-carboxylic acid, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

5-cyclopropyl-1H-pyrazole-3-carboxylic acid (CAS 890591-72-7) is a chemical compound with the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. IUPAC name: 5-cyclopropyl-1H-pyrazole-3-carboxylic acid. InChIKey: GNWMHLBUCXEXPE-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8N2O2
Molecular weight152.15 g/mol
IUPAC name5-cyclopropyl-1H-pyrazole-3-carboxylic acid
InChIKeyGNWMHLBUCXEXPE-UHFFFAOYSA-N
SMILESC1CC1C2=CC(=NN2)C(=O)O

Computed by PubChem (NCBI)