Products 890603-20-0

CAS 890603-20-0 is the registry number for 3-(4-Bromo-3,5-dimethyl-1H-pyrazol-1-yl)-2-methylpropanoic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methylpropanoic acid (CAS 890603-20-0) is a chemical compound with the molecular formula C9H13BrN2O2 and a molecular weight of 261.12 g/mol. IUPAC name: 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methylpropanoic acid. InChIKey: BZLIXBYMKOSUCJ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13BrN2O2
Molecular weight261.12 g/mol
IUPAC name3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methylpropanoic acid
InChIKeyBZLIXBYMKOSUCJ-UHFFFAOYSA-N
SMILESCC1=C(C(=NN1CC(C)C(=O)O)C)Br

Computed by PubChem (NCBI)