CAS 890603-20-0 is the registry number for 3-(4-Bromo-3,5-dimethyl-1H-pyrazol-1-yl)-2-methylpropanoic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methylpropanoic acid (CAS 890603-20-0) is a chemical compound with the molecular formula C9H13BrN2O2 and a molecular weight of 261.12 g/mol. IUPAC name: 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methylpropanoic acid. InChIKey: BZLIXBYMKOSUCJ-UHFFFAOYSA-N.
| Molecular formula | C9H13BrN2O2 |
|---|---|
| Molecular weight | 261.12 g/mol |
| IUPAC name | 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-2-methylpropanoic acid |
| InChIKey | BZLIXBYMKOSUCJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC(C)C(=O)O)C)Br |
Computed by PubChem (NCBI)