Products 890934-28-8
CAS 890934-28-8 appears in our catalog under these names: 3-Chloro-2-fluorobenzaldehyde oxime, 98%, 98%, 3-Chloro-2-fluorobenzaldehyde oxime, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g.
(NE)-N-[(3-chloro-2-fluorophenyl)methylidene]hydroxylamine (CAS 890934-28-8) is a chemical compound with the molecular formula C7H5ClFNO and a molecular weight of 173.57 g/mol. IUPAC name: (NE)-N-[(3-chloro-2-fluorophenyl)methylidene]hydroxylamine. InChIKey: DVVQELKQJJTHIY-ONNFQVAWSA-N.
| Molecular formula | C7H5ClFNO |
|---|---|
| Molecular weight | 173.57 g/mol |
| IUPAC name | (NE)-N-[(3-chloro-2-fluorophenyl)methylidene]hydroxylamine |
| InChIKey | DVVQELKQJJTHIY-ONNFQVAWSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)F)/C=N/O |
Computed by PubChem (NCBI)
Synonyms:
3-Chloro-2-fluorobenzaldehyde oxime