Products 891075-67-5
CAS 891075-67-5 is the registry number for AKR1C3-IN-12. Offered by: MedChemExpress. Available pack sizes: Get quote.
8-hydroxy-2-imino-N-(4-methylphenyl)chromene-3-carboxamide (CAS 891075-67-5) is a chemical compound with the molecular formula C17H14N2O3 and a molecular weight of 294.30 g/mol. IUPAC name: 8-hydroxy-2-imino-N-(4-methylphenyl)chromene-3-carboxamide. InChIKey: SKZQOFVKMNLPBF-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O3 |
|---|---|
| Molecular weight | 294.30 g/mol |
| IUPAC name | 8-hydroxy-2-imino-N-(4-methylphenyl)chromene-3-carboxamide |
| InChIKey | SKZQOFVKMNLPBF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC(=O)C2=CC3=C(C(=CC=C3)O)OC2=N |
Computed by PubChem (NCBI)