Products 891392-96-4
CAS 891392-96-4 is the registry number for 1-(Pyrazin-2-yl)piperidine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
1-pyrazin-2-ylpiperidine-3-carboxylic acid (CAS 891392-96-4) is a chemical compound with the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. IUPAC name: 1-pyrazin-2-ylpiperidine-3-carboxylic acid. InChIKey: DQZQBNKOVJNCRU-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O2 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | 1-pyrazin-2-ylpiperidine-3-carboxylic acid |
| InChIKey | DQZQBNKOVJNCRU-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C2=NC=CN=C2)C(=O)O |
Computed by PubChem (NCBI)