Products 891952-39-9
CAS 891952-39-9 is the registry number for Compound E511-2814/ 99.03% (existing batch purity). Offered by: TargetMol. Available pack sizes: 1mg.
4-piperidin-1-ylsulfonyl-N-(pyridin-3-ylmethyl)-1H-pyrrole-2-carboxamide (CAS 891952-39-9) is a chemical compound with the molecular formula C16H20N4O3S and a molecular weight of 348.4 g/mol. IUPAC name: 4-piperidin-1-ylsulfonyl-N-(pyridin-3-ylmethyl)-1H-pyrrole-2-carboxamide. InChIKey: YLTFZKPDTSWNAA-UHFFFAOYSA-N.
| Molecular formula | C16H20N4O3S |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | 4-piperidin-1-ylsulfonyl-N-(pyridin-3-ylmethyl)-1H-pyrrole-2-carboxamide |
| InChIKey | YLTFZKPDTSWNAA-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)S(=O)(=O)C2=CNC(=C2)C(=O)NCC3=CN=CC=C3 |
Computed by PubChem (NCBI)
Synonyms:
Compound E511-2814