Products 89246-40-2
CAS 89246-40-2 appears in our catalog under these names: N-(3-Cyanophenyl)-2-phenylacetamide 97%, N-(3-Cyanophenyl)benzeneacetamide. Offered by: Ambeed, TRC. Available pack sizes: 50mg, 100mg, 250mg, 1g.
N-(3-cyanophenyl)-2-phenylacetamide (CAS 89246-40-2) is a chemical compound with the molecular formula C15H12N2O and a molecular weight of 236.27 g/mol. IUPAC name: N-(3-cyanophenyl)-2-phenylacetamide. InChIKey: AFBIVMWJUFLUNW-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | N-(3-cyanophenyl)-2-phenylacetamide |
| InChIKey | AFBIVMWJUFLUNW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(=O)NC2=CC=CC(=C2)C#N |
Computed by PubChem (NCBI)