CAS 16151-03-4 is the registry number for 3-(4-Methylphenyl)-5-phenyl-1,2,4-oxadiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
3-(4-methylphenyl)-5-phenyl-1,2,4-oxadiazole (CAS 16151-03-4) is a chemical compound with the molecular formula C15H12N2O and a molecular weight of 236.27 g/mol. IUPAC name: 3-(4-methylphenyl)-5-phenyl-1,2,4-oxadiazole. InChIKey: GZLTUHPTDPXMHI-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | 3-(4-methylphenyl)-5-phenyl-1,2,4-oxadiazole |
| InChIKey | GZLTUHPTDPXMHI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NOC(=N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)