Products 892874-34-9
CAS 892874-34-9 appears in our catalog under these names: 7–Bromoquinoline–3–carboxylic acid, 7-Bromoquinoline-3-carboxylic acid, 7-Bromoquinoline-3-carboxylic acid 95%, 7-Bromoquinoline-3-carboxylic acid, 95%, 95%, 7-Bromoquinoline-3-carboxylic acid, 97%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 2,5g, 10g, 500mg.
7-bromoquinoline-3-carboxylic acid (CAS 892874-34-9) is a chemical compound with the molecular formula C10H6BrNO2 and a molecular weight of 252.06 g/mol. IUPAC name: 7-bromoquinoline-3-carboxylic acid. InChIKey: SNZFKPMLLXPGME-UHFFFAOYSA-N.
| Molecular formula | C10H6BrNO2 |
|---|---|
| Molecular weight | 252.06 g/mol |
| IUPAC name | 7-bromoquinoline-3-carboxylic acid |
| InChIKey | SNZFKPMLLXPGME-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=NC=C(C=C21)C(=O)O)Br |
Computed by PubChem (NCBI)