Products 89315-20-8

CAS 89315-20-8 is the registry number for 1,3-Dichloropyrene. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg, 5mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

1,3-dichloropyrene (CAS 89315-20-8) is a chemical compound with the molecular formula C16H8Cl2 and a molecular weight of 271.1 g/mol. IUPAC name: 1,3-dichloropyrene. InChIKey: XYLXEWWJLMKRCG-UHFFFAOYSA-N.

Identity
Molecular formulaC16H8Cl2
Molecular weight271.1 g/mol
IUPAC name1,3-dichloropyrene
InChIKeyXYLXEWWJLMKRCG-UHFFFAOYSA-N
SMILESC1=CC2=C3C(=C1)C=CC4=C(C=C(C(=C43)C=C2)Cl)Cl

Computed by PubChem (NCBI)