CAS 89315-20-8 is the registry number for 1,3-Dichloropyrene. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg, 5mg, 25mg, 50mg.
1,3-dichloropyrene (CAS 89315-20-8) is a chemical compound with the molecular formula C16H8Cl2 and a molecular weight of 271.1 g/mol. IUPAC name: 1,3-dichloropyrene. InChIKey: XYLXEWWJLMKRCG-UHFFFAOYSA-N.
| Molecular formula | C16H8Cl2 |
|---|---|
| Molecular weight | 271.1 g/mol |
| IUPAC name | 1,3-dichloropyrene |
| InChIKey | XYLXEWWJLMKRCG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=CC4=C(C=C(C(=C43)C=C2)Cl)Cl |
Computed by PubChem (NCBI)