CAS 89315-21-9 is the registry number for 1,6-Dichloropyrene, >95% (GC). Offered by: TRC. Available pack sizes: 25mg, 50mg, 5mg.
1,6-dichloropyrene (CAS 89315-21-9) is a chemical compound with the molecular formula C16H8Cl2 and a molecular weight of 271.1 g/mol. IUPAC name: 1,6-dichloropyrene. InChIKey: QSWWVQQLTGBNDL-UHFFFAOYSA-N.
| Molecular formula | C16H8Cl2 |
|---|---|
| Molecular weight | 271.1 g/mol |
| IUPAC name | 1,6-dichloropyrene |
| InChIKey | QSWWVQQLTGBNDL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC3=C2C4=C1C=CC(=C4C=C3)Cl)Cl |
Computed by PubChem (NCBI)