CAS 89333-97-1 appears in our catalog under these names: 2,9-Bis(4-methoxyphenyl)-1,10-phenanthroline, 97%, 2,9-Bis(4-methoxyphenyl)-1,10-phenanthroline. Offered by: Ambeed, Biosynth. Available pack sizes: 1g, 100mg, 250mg, 5000mg.
2,9-bis(4-methoxyphenyl)-1,10-phenanthroline (CAS 89333-97-1) is a chemical compound with the molecular formula C26H20N2O2 and a molecular weight of 392.4 g/mol. IUPAC name: 2,9-bis(4-methoxyphenyl)-1,10-phenanthroline. InChIKey: UCCSXBZGZACZAB-UHFFFAOYSA-N.
| Molecular formula | C26H20N2O2 |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | 2,9-bis(4-methoxyphenyl)-1,10-phenanthroline |
| InChIKey | UCCSXBZGZACZAB-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NC3=C(C=CC4=C3N=C(C=C4)C5=CC=C(C=C5)OC)C=C2 |
Computed by PubChem (NCBI)