Products 95950-20-2
CAS 95950-20-2 appears in our catalog under these names: 4,7-Bis(4-methoxyphenyl)-1,10-phenanthroline, 98%, 98%, 4,7-Bis(4-methoxyphenyl)-1,10-phenanthroline, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg.
4,7-bis(4-methoxyphenyl)-1,10-phenanthroline (CAS 95950-20-2) is a chemical compound with the molecular formula C26H20N2O2 and a molecular weight of 392.4 g/mol. IUPAC name: 4,7-bis(4-methoxyphenyl)-1,10-phenanthroline. InChIKey: FUOQHQZASFBART-UHFFFAOYSA-N.
| Molecular formula | C26H20N2O2 |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | 4,7-bis(4-methoxyphenyl)-1,10-phenanthroline |
| InChIKey | FUOQHQZASFBART-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C3C=CC4=C(C=CN=C4C3=NC=C2)C5=CC=C(C=C5)OC |
Computed by PubChem (NCBI)