Products 893722-03-7
CAS 893722-03-7 appears in our catalog under these names: 7-Bromo-8-(chloromethyl)-3,4-dihydro-2H-1,5-benzodioxepine, 95%, 7-Bromo-8-(chloromethyl)-3,4-dihydro-2H-1,5-benzodioxepine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
7-bromo-8-(chloromethyl)-3,4-dihydro-2H-1,5-benzodioxepine (CAS 893722-03-7) is a chemical compound with the molecular formula C10H10BrClO2 and a molecular weight of 277.54 g/mol. IUPAC name: 7-bromo-8-(chloromethyl)-3,4-dihydro-2H-1,5-benzodioxepine. InChIKey: ONPBBZOESDHYSC-UHFFFAOYSA-N.
| Molecular formula | C10H10BrClO2 |
|---|---|
| Molecular weight | 277.54 g/mol |
| IUPAC name | 7-bromo-8-(chloromethyl)-3,4-dihydro-2H-1,5-benzodioxepine |
| InChIKey | ONPBBZOESDHYSC-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=C(C(=C2)CCl)Br)OC1 |
Computed by PubChem (NCBI)