Products 893737-59-2
CAS 893737-59-2 is the registry number for 2-Hydroxy-5-(5-pyrimidinyl)benzaldehyde, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg.
2-hydroxy-5-pyrimidin-5-ylbenzaldehyde (CAS 893737-59-2) is a chemical compound with the molecular formula C11H8N2O2 and a molecular weight of 200.19 g/mol. IUPAC name: 2-hydroxy-5-pyrimidin-5-ylbenzaldehyde. InChIKey: HPQAHGRGPPOWML-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O2 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | 2-hydroxy-5-pyrimidin-5-ylbenzaldehyde |
| InChIKey | HPQAHGRGPPOWML-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CN=CN=C2)C=O)O |
Computed by PubChem (NCBI)