Products 894106-43-5

CAS 894106-43-5 is the registry number for Fmoc-L-Lys(Acryloyl)-OH. Offered by: Iris Biotech. Available pack sizes: 500mg, 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(prop-2-enoylamino)hexanoic acid (CAS 894106-43-5) is a chemical compound with the molecular formula C24H26N2O5 and a molecular weight of 422.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(prop-2-enoylamino)hexanoic acid. InChIKey: WIDAXYNHIPZWMC-NRFANRHFSA-N.

Identity
Molecular formulaC24H26N2O5
Molecular weight422.5 g/mol
IUPAC name(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(prop-2-enoylamino)hexanoic acid
InChIKeyWIDAXYNHIPZWMC-NRFANRHFSA-N
SMILESC=CC(=O)NCCCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13

Computed by PubChem (NCBI)