CAS 89422-73-1 is the registry number for 1,3,6,8-Tetrachloro-2,7-dinitro-dibenzo(1,4)dioxin. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
Gamma-eudesmol is a eudesmane sesquiterpenoid in which the eudesmane skeleton carries a hydroxy substituent at C-11 and has a double bond between C-4 and C-5. It has a role as a volatile oil component.
Source: ChEBI
| Molecular formula | C15H26O |
|---|---|
| Molecular weight | 222.37 g/mol |
| IUPAC name | 2-[(2R,4aR)-4a,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]propan-2-ol |
| InChIKey | WMOPMQRJLLIEJV-IUODEOHRSA-N |
| SMILES | CC1=C2C[C@@H](CC[C@]2(CCC1)C)C(C)(C)O |
Computed by PubChem (NCBI)