CAS 895155-95-0 appears in our catalog under these names: UR-144 N-(5-Hydroxypentyl), UR-144 N-(5-hydroxypentyl) metabolite, UR-144 N-(5-hydroxypentyl) metabolite, 0.1mg/ml in Methanol, UR-144 N-(5-hydroxypentyl) metabolite, 1mg/ml in Methanol, UR–144 N–(5–hydroxypentyl) metabolite. Offered by: TRC, Lipomed, GLPBio, Biosynth. Available pack sizes: 100mg, 50mg, 10mg, 1ml, 1mg, 5mg, 25mg.
[1-(5-hydroxypentyl)indol-3-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone (CAS 895155-95-0) is a chemical compound with the molecular formula C21H29NO2 and a molecular weight of 327.5 g/mol. IUPAC name: [1-(5-hydroxypentyl)indol-3-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone. InChIKey: AFWBYMXUEMOBRP-UHFFFAOYSA-N.
| Molecular formula | C21H29NO2 |
|---|---|
| Molecular weight | 327.5 g/mol |
| IUPAC name | [1-(5-hydroxypentyl)indol-3-yl]-(2,2,3,3-tetramethylcyclopropyl)methanone |
| InChIKey | AFWBYMXUEMOBRP-UHFFFAOYSA-N |
| SMILES | CC1(C(C1(C)C)C(=O)C2=CN(C3=CC=CC=C32)CCCCCO)C |
Computed by PubChem (NCBI)