Products 89667-39-0
CAS 89667-39-0 appears in our catalog under these names: (6Z)-7-Phenyl-7-(3-Pyridinyl)-6-Heptenoic Acid/ 99%, (6Z)-7-Phenyl-7-(3-Pyridinyl)-6-Heptenoic Acid. Offered by: TargetMol, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
(Z)-7-phenyl-7-pyridin-3-ylhept-6-enoic acid (CAS 89667-39-0) is a chemical compound with the molecular formula C18H19NO2 and a molecular weight of 281.3 g/mol. IUPAC name: (Z)-7-phenyl-7-pyridin-3-ylhept-6-enoic acid. InChIKey: UWPBQLKEHGGKKD-BOPFTXTBSA-N.
| Molecular formula | C18H19NO2 |
|---|---|
| Molecular weight | 281.3 g/mol |
| IUPAC name | (Z)-7-phenyl-7-pyridin-3-ylhept-6-enoic acid |
| InChIKey | UWPBQLKEHGGKKD-BOPFTXTBSA-N |
| SMILES | C1=CC=C(C=C1)/C(=C/CCCCC(=O)O)/C2=CN=CC=C2 |
Computed by PubChem (NCBI)
Synonyms:
(6Z)-7-Phenyl-7-(3-Pyridinyl)-6-Heptenoic Acid, (Z)-7-phenyl-7-pyridin-3-ylhept-6-enoic acid, 7-Phenyl-7-pyridin-3-yl-hept-6-enoic acid, orb1819083, UWPBQLKEHGGKKD-BOPFTXTBSA-N, (Z)-7-(3-pyridyl)-7-phenyl-6-heptenoic acid, (Z)-7-Phenyl-7-pyridin-3-yl-hept-6-enoic acid, (Z)-7-Phenyl-7-(pyridin-3-yl)hept-6-enoic acid