CAS 897037-23-9 appears in our catalog under these names: 4'–(4–Methoxycarbonylphenyl)–2,2':6',2''–terpyridine, Methyl 4-([2,2':6',2''-terpyridin]-4'-yl)benzoate 97%, Methyl 4-([2,2':6',2''-terpyridin]-4'-yl)benzoate, 97%, 97%, 4'-(4-Methoxycarbonylphenyl)-2,2':6',2''-terpyridine, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
Methyl 4-(2,6-dipyridin-2-yl-4-pyridinyl)benzoate (CAS 897037-23-9) is a chemical compound with the molecular formula C23H17N3O2 and a molecular weight of 367.4 g/mol. IUPAC name: methyl 4-(2,6-dipyridin-2-yl-4-pyridinyl)benzoate. InChIKey: ZZLJNYAUCYCXHT-UHFFFAOYSA-N.
| Molecular formula | C23H17N3O2 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | methyl 4-(2,6-dipyridin-2-yl-4-pyridinyl)benzoate |
| InChIKey | ZZLJNYAUCYCXHT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=CC(=NC(=C2)C3=CC=CC=N3)C4=CC=CC=N4 |
Computed by PubChem (NCBI)